C17H19N3O4 — CID 108539918
N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]pyridine-4-carboxamide (PubChem CID 108539918) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]pyridine-4-carboxamide.
| Compound Name | N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 108539918 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]pyridine-4-carboxamide |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)NCCNC(=O)c1ccncc1 |
| InChI | InChI=1S/C17H19N3O4/c1-12(24-15-4-2-14(21)3-5-15)16(22)19-10-11-20-17(23)13-6-8-18-9-7-13/h2-9,12,21H,10-11H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | ZDGHVATVDLXXNW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|