C19H19F3N2O4 — CID 108539901
N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]-2-(trifluoromethyl)benzamide (PubChem CID 108539901) has the molecular formula C19H19F3N2O4 and a molecular weight of 396.37 g/mol. Its IUPAC name is N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108539901 |
| Molecular Formula | C19H19F3N2O4 |
| Molecular Weight | 396.37 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | N-[2-[2-(4-hydroxyphenoxy)propanoylamino]ethyl]-2-(trifluoromethyl)benzamide |
| SMILES | CC(Oc1ccc(O)cc1)C(=O)NCCNC(=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C19H19F3N2O4/c1-12(28-14-8-6-13(25)7-9-14)17(26)23-10-11-24-18(27)15-4-2-3-5-16(15)19(20,21)22/h2-9,12,25H,10-11H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | DXLLQZFVOOEWTQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|