C15H17NO5S — CID 78872860
5-(methoxymethyl)-N-[(4-methylsulfonylphenyl)methyl]furan-2-carboxamide (PubChem CID 78872860) has the molecular formula C15H17NO5S and a molecular weight of 323.37 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[(4-methylsulfonylphenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[(4-methylsulfonylphenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78872860 |
| Molecular Formula | C15H17NO5S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 5-(methoxymethyl)-N-[(4-methylsulfonylphenyl)methyl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)NCc2ccc(S(C)(=O)=O)cc2)o1 |
| InChI | InChI=1S/C15H17NO5S/c1-20-10-12-5-8-14(21-12)15(17)16-9-11-3-6-13(7-4-11)22(2,18)19/h3-8H,9-10H2,1-2H3,(H,16,17) |
| InChIKey | NYCYDIXFALNLRK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |