C14H20ClF2IN2O — CID 119598136
N-(1-amino-2,4-dimethylpentan-2-yl)-4,5-difluoro-2-iodobenzamide;hydrochloride (PubChem CID 119598136) has the molecular formula C14H20ClF2IN2O and a molecular weight of 432.68 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-4,5-difluoro-2-iodobenzamide;hydrochloride.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4,5-difluoro-2-iodobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119598136 |
| Molecular Formula | C14H20ClF2IN2O |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.03 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-4,5-difluoro-2-iodobenzamide;hydrochloride |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1cc(F)c(F)cc1I.Cl |
| InChI | InChI=1S/C14H19F2IN2O.ClH/c1-8(2)6-14(3,7-18)19-13(20)9-4-10(15)11(16)5-12(9)17;/h4-5,8H,6-7,18H2,1-3H3,(H,19,20);1H |
| InChIKey | SESXLEWYFIVAOF-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|