C14H21ClFN3O3 — CID 119599327
N-(1-amino-2,4-dimethylpentan-2-yl)-5-fluoro-2-nitrobenzamide;hydrochloride (PubChem CID 119599327) has the molecular formula C14H21ClFN3O3 and a molecular weight of 333.79 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-5-fluoro-2-nitrobenzamide;hydrochloride.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-fluoro-2-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119599327 |
| Molecular Formula | C14H21ClFN3O3 |
| Molecular Weight | 333.79 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-fluoro-2-nitrobenzamide;hydrochloride |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1cc(F)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H20FN3O3.ClH/c1-9(2)7-14(3,8-16)17-13(19)11-6-10(15)4-5-12(11)18(20)21;/h4-6,9H,7-8,16H2,1-3H3,(H,17,19);1H |
| InChIKey | PAFIKCGQXNEXFC-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.79 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|