C14H20ClIN2O — CID 103807187
N-(1-amino-2,4-dimethylpentan-2-yl)-5-chloro-2-iodobenzamide (PubChem CID 103807187) has the molecular formula C14H20ClIN2O and a molecular weight of 394.68 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-5-chloro-2-iodobenzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-chloro-2-iodobenzamide |
|---|---|
| PubChem CID | 103807187 |
| Molecular Formula | C14H20ClIN2O |
| Molecular Weight | 394.68 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-5-chloro-2-iodobenzamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1cc(Cl)ccc1I |
| InChI | InChI=1S/C14H20ClIN2O/c1-9(2)7-14(3,8-17)18-13(19)11-6-10(15)4-5-12(11)16/h4-6,9H,7-8,17H2,1-3H3,(H,18,19) |
| InChIKey | BSOXXNIDMRPIQK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|