C14H22N2O3 — CID 107725269
N-(1-amino-2,4-dimethylpentan-2-yl)-2,5-dihydroxybenzamide (PubChem CID 107725269) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2,5-dihydroxybenzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107725269 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2,5-dihydroxybenzamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H22N2O3/c1-9(2)7-14(3,8-15)16-13(19)11-6-10(17)4-5-12(11)18/h4-6,9,17-18H,7-8,15H2,1-3H3,(H,16,19) |
| InChIKey | YXMWZWHCDWTAIQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|