C15H24N2O3 — CID 115309726
N-(1-amino-2,4-dimethylpentan-2-yl)-2-hydroxy-4-methoxybenzamide (PubChem CID 115309726) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2-hydroxy-4-methoxybenzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 115309726 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(C)(CN)CC(C)C)c(O)c1 |
| InChI | InChI=1S/C15H24N2O3/c1-10(2)8-15(3,9-16)17-14(19)12-6-5-11(20-4)7-13(12)18/h5-7,10,18H,8-9,16H2,1-4H3,(H,17,19) |
| InChIKey | ABGFEXWXKQMJNK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |