C14H20Br2N2O — CID 107940162
N-(1-amino-2,4-dimethylpentan-2-yl)-2,4-dibromobenzamide (PubChem CID 107940162) has the molecular formula C14H20Br2N2O and a molecular weight of 392.14 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-2,4-dibromobenzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2,4-dibromobenzamide |
|---|---|
| PubChem CID | 107940162 |
| Molecular Formula | C14H20Br2N2O |
| Molecular Weight | 392.14 g/mol |
| Exact Mass | 389.99 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-2,4-dibromobenzamide |
| SMILES | CC(C)CC(C)(CN)NC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C14H20Br2N2O/c1-9(2)7-14(3,8-17)18-13(19)11-5-4-10(15)6-12(11)16/h4-6,9H,7-8,17H2,1-3H3,(H,18,19) |
| InChIKey | DPFRTDSXIXSLTE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |