C15H23BrN2O — CID 81485460
N-(1-amino-2,4-dimethylpentan-2-yl)-3-bromo-2-methylbenzamide (PubChem CID 81485460) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is N-(1-amino-2,4-dimethylpentan-2-yl)-3-bromo-2-methylbenzamide.
| Compound Name | N-(1-amino-2,4-dimethylpentan-2-yl)-3-bromo-2-methylbenzamide |
|---|---|
| PubChem CID | 81485460 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(1-amino-2,4-dimethylpentan-2-yl)-3-bromo-2-methylbenzamide |
| SMILES | Cc1c(Br)cccc1C(=O)NC(C)(CN)CC(C)C |
| InChI | InChI=1S/C15H23BrN2O/c1-10(2)8-15(4,9-17)18-14(19)12-6-5-7-13(16)11(12)3/h5-7,10H,8-9,17H2,1-4H3,(H,18,19) |
| InChIKey | WNWUORJZVIHJRV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |