C14H20FN3O3S — CID 119475981
N-(4-aminocyclohexyl)-4-fluoro-3-(methanesulfonamido)benzamide (PubChem CID 119475981) has the molecular formula C14H20FN3O3S and a molecular weight of 329.40 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-fluoro-3-(methanesulfonamido)benzamide.
| Compound Name | N-(4-aminocyclohexyl)-4-fluoro-3-(methanesulfonamido)benzamide |
|---|---|
| PubChem CID | 119475981 |
| Molecular Formula | C14H20FN3O3S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-fluoro-3-(methanesulfonamido)benzamide |
| SMILES | CS(=O)(=O)Nc1cc(C(=O)NC2CCC(N)CC2)ccc1F |
| InChI | InChI=1S/C14H20FN3O3S/c1-22(20,21)18-13-8-9(2-7-12(13)15)14(19)17-11-5-3-10(16)4-6-11/h2,7-8,10-11,18H,3-6,16H2,1H3,(H,17,19) |
| InChIKey | LLCDCZXXWAFKFQ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |