C19H19F3N2O — CID 119479149
N-(4-aminocyclohexyl)-4-(3,4,5-trifluorophenyl)benzamide (PubChem CID 119479149) has the molecular formula C19H19F3N2O and a molecular weight of 348.37 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-4-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | N-(4-aminocyclohexyl)-4-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 119479149 |
| Molecular Formula | C19H19F3N2O |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | N-(4-aminocyclohexyl)-4-(3,4,5-trifluorophenyl)benzamide |
| SMILES | NC1CCC(NC(=O)c2ccc(-c3cc(F)c(F)c(F)c3)cc2)CC1 |
| InChI | InChI=1S/C19H19F3N2O/c20-16-9-13(10-17(21)18(16)22)11-1-3-12(4-2-11)19(25)24-15-7-5-14(23)6-8-15/h1-4,9-10,14-15H,5-8,23H2,(H,24,25) |
| InChIKey | LQFFBQDTCUAPNT-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|