C14H19FN2O5S — CID 119955015
2-[butan-2-yl-[4-fluoro-3-(methanesulfonamido)benzoyl]amino]acetic acid (PubChem CID 119955015) has the molecular formula C14H19FN2O5S and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-[butan-2-yl-[4-fluoro-3-(methanesulfonamido)benzoyl]amino]acetic acid.
| Compound Name | 2-[butan-2-yl-[4-fluoro-3-(methanesulfonamido)benzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 119955015 |
| Molecular Formula | C14H19FN2O5S |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[butan-2-yl-[4-fluoro-3-(methanesulfonamido)benzoyl]amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)c1ccc(F)c(NS(C)(=O)=O)c1 |
| InChI | InChI=1S/C14H19FN2O5S/c1-4-9(2)17(8-13(18)19)14(20)10-5-6-11(15)12(7-10)16-23(3,21)22/h5-7,9,16H,4,8H2,1-3H3,(H,18,19) |
| InChIKey | GDNPNPAPSSBCHB-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |