C11H10FN3O4S — CID 80583821
3-fluoro-2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]benzoic acid (PubChem CID 80583821) has the molecular formula C11H10FN3O4S and a molecular weight of 299.28 g/mol. Its IUPAC name is 3-fluoro-2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]benzoic acid.
| Compound Name | 3-fluoro-2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 80583821 |
| Molecular Formula | C11H10FN3O4S |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 3-fluoro-2-[(5-methyl-1H-pyrazol-4-yl)sulfonylamino]benzoic acid |
| SMILES | Cc1[nH]ncc1S(=O)(=O)Nc1c(F)cccc1C(=O)O |
| InChI | InChI=1S/C11H10FN3O4S/c1-6-9(5-13-14-6)20(18,19)15-10-7(11(16)17)3-2-4-8(10)12/h2-5,15H,1H3,(H,13,14)(H,16,17) |
| InChIKey | DKIPKQKWIUJKMT-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |