C10H10ClN3O4S2 — CID 102691035
2-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzenesulfonyl chloride (PubChem CID 102691035) has the molecular formula C10H10ClN3O4S2 and a molecular weight of 335.79 g/mol. Its IUPAC name is 2-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzenesulfonyl chloride.
| Compound Name | 2-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 102691035 |
| Molecular Formula | C10H10ClN3O4S2 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 2-methyl-4-(1H-pyrazol-5-ylsulfonylamino)benzenesulfonyl chloride |
| SMILES | Cc1cc(NS(=O)(=O)c2ccn[nH]2)ccc1S(=O)(=O)Cl |
| InChI | InChI=1S/C10H10ClN3O4S2/c1-7-6-8(2-3-9(7)19(11,15)16)14-20(17,18)10-4-5-12-13-10/h2-6,14H,1H3,(H,12,13) |
| InChIKey | LQHRHDSVWVHELS-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |