C8H9N5O2S — CID 102690598
N-(3-amino-2-pyridinyl)-1H-pyrazole-5-sulfonamide (PubChem CID 102690598) has the molecular formula C8H9N5O2S and a molecular weight of 239.26 g/mol. Its IUPAC name is N-(3-amino-2-pyridinyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | N-(3-amino-2-pyridinyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 102690598 |
| Molecular Formula | C8H9N5O2S |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | N-(3-amino-2-pyridinyl)-1H-pyrazole-5-sulfonamide |
| SMILES | Nc1cccnc1NS(=O)(=O)c1ccn[nH]1 |
| InChI | InChI=1S/C8H9N5O2S/c9-6-2-1-4-10-8(6)13-16(14,15)7-3-5-11-12-7/h1-5H,9H2,(H,10,13)(H,11,12) |
| InChIKey | IGTJGAYBMPKOSY-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |