C16H15ClN4O2S2 — CID 113041587
N-[6-[(2-chlorophenyl)methylamino]pyridazin-3-yl]-5-methylthiophene-2-sulfonamide (PubChem CID 113041587) has the molecular formula C16H15ClN4O2S2 and a molecular weight of 394.91 g/mol. Its IUPAC name is N-[6-[(2-chlorophenyl)methylamino]pyridazin-3-yl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[6-[(2-chlorophenyl)methylamino]pyridazin-3-yl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 113041587 |
| Molecular Formula | C16H15ClN4O2S2 |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | N-[6-[(2-chlorophenyl)methylamino]pyridazin-3-yl]-5-methylthiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)Nc2ccc(NCc3ccccc3Cl)nn2)s1 |
| InChI | InChI=1S/C16H15ClN4O2S2/c1-11-6-9-16(24-11)25(22,23)21-15-8-7-14(19-20-15)18-10-12-4-2-3-5-13(12)17/h2-9H,10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | XUBMZDCUEXWCFC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |