C19H20N4O3S — CID 113048267
N-[6-(3-methoxyanilino)pyridazin-3-yl]-2-phenylethanesulfonamide (PubChem CID 113048267) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[6-(3-methoxyanilino)pyridazin-3-yl]-2-phenylethanesulfonamide.
| Compound Name | N-[6-(3-methoxyanilino)pyridazin-3-yl]-2-phenylethanesulfonamide |
|---|---|
| PubChem CID | 113048267 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | N-[6-(3-methoxyanilino)pyridazin-3-yl]-2-phenylethanesulfonamide |
| SMILES | COc1cccc(Nc2ccc(NS(=O)(=O)CCc3ccccc3)nn2)c1 |
| InChI | InChI=1S/C19H20N4O3S/c1-26-17-9-5-8-16(14-17)20-18-10-11-19(22-21-18)23-27(24,25)13-12-15-6-3-2-4-7-15/h2-11,14H,12-13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | ZGBYJVGPRYOFHV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |