C13H13NO3S2 — CID 6493654
N-(4-prop-2-enoxyphenyl)thiophene-2-sulfonamide (PubChem CID 6493654) has the molecular formula C13H13NO3S2 and a molecular weight of 295.39 g/mol. Its IUPAC name is N-(4-prop-2-enoxyphenyl)thiophene-2-sulfonamide.
| Compound Name | N-(4-prop-2-enoxyphenyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 6493654 |
| Molecular Formula | C13H13NO3S2 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | N-(4-prop-2-enoxyphenyl)thiophene-2-sulfonamide |
| SMILES | C=CCOc1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H13NO3S2/c1-2-9-17-12-7-5-11(6-8-12)14-19(15,16)13-4-3-10-18-13/h2-8,10,14H,1,9H2 |
| InChIKey | MGJSGNBNCCFBNJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|