C13H12N2O2S2 — CID 60814116
N-[4-(3-aminoprop-1-ynyl)phenyl]thiophene-2-sulfonamide (PubChem CID 60814116) has the molecular formula C13H12N2O2S2 and a molecular weight of 292.39 g/mol. Its IUPAC name is N-[4-(3-aminoprop-1-ynyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[4-(3-aminoprop-1-ynyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 60814116 |
| Molecular Formula | C13H12N2O2S2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | N-[4-(3-aminoprop-1-ynyl)phenyl]thiophene-2-sulfonamide |
| SMILES | NCC#Cc1ccc(NS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C13H12N2O2S2/c14-9-1-3-11-5-7-12(8-6-11)15-19(16,17)13-4-2-10-18-13/h2,4-8,10,15H,9,14H2 |
| InChIKey | AHIMFSAOJZSCAM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|