C25H24N2S — CID 138392955
N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine (PubChem CID 138392955) has the molecular formula C25H24N2S and a molecular weight of 384.55 g/mol. Its IUPAC name is N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine.
| Compound Name | N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 138392955 |
| Molecular Formula | C25H24N2S |
| Molecular Weight | 384.55 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-(2-methylphenyl)-4-(4-methylphenyl)-3-(2-phenylethyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(-c2cs/c(=N\c3ccccc3C)n2CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2S/c1-19-12-14-22(15-13-19)24-18-28-25(26-23-11-7-6-8-20(23)2)27(24)17-16-21-9-4-3-5-10-21/h3-15,18H,16-17H2,1-2H3/b26-25- |
| InChIKey | NWVFYMZLKWHSRX-QPLCGJKRSA-N |
| XLogP | 6.31 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.55 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|