C17H24N2O3S — CID 7540957
N-(5,6-dimethoxy-3-propyl-1,3-benzothiazol-2-ylidene)pentanamide (PubChem CID 7540957) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is N-(5,6-dimethoxy-3-propyl-1,3-benzothiazol-2-ylidene)pentanamide.
| Compound Name | N-(5,6-dimethoxy-3-propyl-1,3-benzothiazol-2-ylidene)pentanamide |
|---|---|
| PubChem CID | 7540957 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | N-(5,6-dimethoxy-3-propyl-1,3-benzothiazol-2-ylidene)pentanamide |
| SMILES | CCCCC(=O)/N=c1\sc2cc(OC)c(OC)cc2n1CCC |
| InChI | InChI=1S/C17H24N2O3S/c1-5-7-8-16(20)18-17-19(9-6-2)12-10-13(21-3)14(22-4)11-15(12)23-17/h10-11H,5-9H2,1-4H3/b18-17- |
| InChIKey | LEQVTBPMNUQPJO-ZCXUNETKSA-N |
| XLogP | 3.75 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |