C26H36N4O2S — CID 21022225
N-butyl-6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-imine (PubChem CID 21022225) has the molecular formula C26H36N4O2S and a molecular weight of 468.67 g/mol. Its IUPAC name is N-butyl-6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-imine.
| Compound Name | N-butyl-6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 21022225 |
| Molecular Formula | C26H36N4O2S |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | N-butyl-6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-imine |
| SMILES | [H]/N=N/c1cc2s/c(=N\CCCC)n(C(C)COc3ccccc3)c2cc1OCCCCCC |
| InChI | InChI=1S/C26H36N4O2S/c1-4-6-8-12-16-31-24-18-23-25(17-22(24)29-27)33-26(28-15-7-5-2)30(23)20(3)19-32-21-13-10-9-11-14-21/h9-11,13-14,17-18,20,27H,4-8,12,15-16,19H2,1-3H3/b28-26-,29-27+ |
| InChIKey | TUBXDHCVAGWIOW-CMFFYZNBSA-N |
| XLogP | 7.67 |
| TPSA | 71.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|