C31H45N5O3S — CID 59000279
1-[6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-ylidene]-3-octylurea (PubChem CID 59000279) has the molecular formula C31H45N5O3S and a molecular weight of 567.80 g/mol. Its IUPAC name is 1-[6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-ylidene]-3-octylurea.
| Compound Name | 1-[6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-ylidene]-3-octylurea |
|---|---|
| PubChem CID | 59000279 |
| Molecular Formula | C31H45N5O3S |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.32 |
| IUPAC Name | 1-[6-diazenyl-5-hexoxy-3-(1-phenoxypropan-2-yl)-1,3-benzothiazol-2-ylidene]-3-octylurea |
| SMILES | [H]/N=N/c1cc2sc(=NC(=O)NCCCCCCCC)n(C(C)COc3ccccc3)c2cc1OCCCCCC |
| InChI | InChI=1S/C31H45N5O3S/c1-4-6-8-10-11-15-19-33-30(37)34-31-36(24(3)23-39-25-17-13-12-14-18-25)27-22-28(38-20-16-9-7-5-2)26(35-32)21-29(27)40-31/h12-14,17-18,21-22,24,32H,4-11,15-16,19-20,23H2,1-3H3,(H,33,37)/b34-31?,35-32+ |
| InChIKey | LGYWRJJZZLXMFX-SUSPZDDISA-N |
| XLogP | 8.94 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|