C44H66N4O6 — CID 102030458
5-amino-N-[5-[(5-amino-2-butoxybenzoyl)amino]-2,4-dioctoxyphenyl]-2-butoxybenzamide (PubChem CID 102030458) has the molecular formula C44H66N4O6 and a molecular weight of 747.03 g/mol. Its IUPAC name is 5-amino-N-[5-[(5-amino-2-butoxybenzoyl)amino]-2,4-dioctoxyphenyl]-2-butoxybenzamide.
| Compound Name | 5-amino-N-[5-[(5-amino-2-butoxybenzoyl)amino]-2,4-dioctoxyphenyl]-2-butoxybenzamide |
|---|---|
| PubChem CID | 102030458 |
| Molecular Formula | C44H66N4O6 |
| Molecular Weight | 747.03 g/mol |
| Exact Mass | 746.50 |
| IUPAC Name | 5-amino-N-[5-[(5-amino-2-butoxybenzoyl)amino]-2,4-dioctoxyphenyl]-2-butoxybenzamide |
| SMILES | CCCCCCCCOc1cc(OCCCCCCCC)c(NC(=O)c2cc(N)ccc2OCCCC)cc1NC(=O)c1cc(N)ccc1OCCCC |
| InChI | InChI=1S/C44H66N4O6/c1-5-9-13-15-17-19-27-53-41-32-42(54-28-20-18-16-14-10-6-2)38(48-44(50)36-30-34(46)22-24-40(36)52-26-12-8-4)31-37(41)47-43(49)35-29-33(45)21-23-39(35)51-25-11-7-3/h21-24,29-32H,5-20,25-28,45-46H2,1-4H3,(H,47,49)(H,48,50) |
| InChIKey | LDGJQDNXBGQBKN-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 147.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.03 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|