C19H31N3O3 — CID 89176474
5-amino-N-[(2S)-1-amino-1-oxohexan-2-yl]-2-hexoxybenzamide (PubChem CID 89176474) has the molecular formula C19H31N3O3 and a molecular weight of 349.48 g/mol. Its IUPAC name is 5-amino-N-[(2S)-1-amino-1-oxohexan-2-yl]-2-hexoxybenzamide.
| Compound Name | 5-amino-N-[(2S)-1-amino-1-oxohexan-2-yl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 89176474 |
| Molecular Formula | C19H31N3O3 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 5-amino-N-[(2S)-1-amino-1-oxohexan-2-yl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(N)cc1C(=O)N[C@@H](CCCC)C(N)=O |
| InChI | InChI=1S/C19H31N3O3/c1-3-5-7-8-12-25-17-11-10-14(20)13-15(17)19(24)22-16(18(21)23)9-6-4-2/h10-11,13,16H,3-9,12,20H2,1-2H3,(H2,21,23)(H,22,24)/t16-/m0/s1 |
| InChIKey | PIKZSYPLCPMDEH-INIZCTEOSA-N |
| XLogP | 3.00 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|