About 5-amino-2-butoxybenzoate
5-amino-2-butoxybenzoate (PubChem CID 23167453) has the molecular formula C11H14NO3-
and a molecular weight of 208.24 g/mol. Its IUPAC name is 5-amino-2-butoxybenzoate.
Molecular Properties
| Compound Name | 5-amino-2-butoxybenzoate |
| PubChem CID | 23167453 |
| Molecular Formula | C11H14NO3- |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 5-amino-2-butoxybenzoate |
| SMILES | CCCCOc1ccc(N)cc1C(=O)[O-] |
| InChI | InChI=1S/C11H15NO3/c1-2-3-6-15-10-5-4-8(12)7-9(10)11(13)14/h4-5,7H,2-3,6,12H2,1H3,(H,13,14)/p-1 |
| InChIKey | FOHJNOOCTRAVRJ-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2-butoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-butoxybenzoate?
The IUPAC name of 5-amino-2-butoxybenzoate (CID 23167453) is 5-amino-2-butoxybenzoate.
What is the SMILES notation for 5-amino-2-butoxybenzoate?
The canonical SMILES for 5-amino-2-butoxybenzoate is CCCCOc1ccc(N)cc1C(=O)[O-].
What is the InChIKey of 5-amino-2-butoxybenzoate?
The InChIKey is FOHJNOOCTRAVRJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H15NO3/c1-2-3-6-15-10-5-4-8(12)7-9(10)11(13)14/h4-5,7H,2-3,6,12H2,1H3,(H,13,14)/p-1.
What are the key properties of 5-amino-2-butoxybenzoate?
5-amino-2-butoxybenzoate has a molecular weight of 208.24 g/mol, XLogP of 0.81, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-butoxybenzoate is sourced from PubChem (CID 23167453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).