C17H24ClNO4 — CID 69205141
2-[(5-chloro-2-heptoxybenzoyl)amino]propanoic acid (PubChem CID 69205141) has the molecular formula C17H24ClNO4 and a molecular weight of 341.84 g/mol. Its IUPAC name is 2-[(5-chloro-2-heptoxybenzoyl)amino]propanoic acid.
| Compound Name | 2-[(5-chloro-2-heptoxybenzoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 69205141 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.84 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 2-[(5-chloro-2-heptoxybenzoyl)amino]propanoic acid |
| SMILES | CCCCCCCOc1ccc(Cl)cc1C(=O)NC(C)C(=O)O |
| InChI | InChI=1S/C17H24ClNO4/c1-3-4-5-6-7-10-23-15-9-8-13(18)11-14(15)16(20)19-12(2)17(21)22/h8-9,11-12H,3-7,10H2,1-2H3,(H,19,20)(H,21,22) |
| InChIKey | YEJGQNQRQJBIPA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|