C22H25BrCl2N2O4 — CID 17343512
5-bromo-N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-hexoxybenzohydrazide (PubChem CID 17343512) has the molecular formula C22H25BrCl2N2O4 and a molecular weight of 532.26 g/mol. Its IUPAC name is 5-bromo-N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-hexoxybenzohydrazide.
| Compound Name | 5-bromo-N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-hexoxybenzohydrazide |
|---|---|
| PubChem CID | 17343512 |
| Molecular Formula | C22H25BrCl2N2O4 |
| Molecular Weight | 532.26 g/mol |
| Exact Mass | 530.04 |
| IUPAC Name | 5-bromo-N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NNC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H25BrCl2N2O4/c1-3-4-5-6-11-30-19-9-7-15(23)12-17(19)22(29)27-26-21(28)14(2)31-20-10-8-16(24)13-18(20)25/h7-10,12-14H,3-6,11H2,1-2H3,(H,26,28)(H,27,29) |
| InChIKey | ZIUDKTRORUVCTE-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.26 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|