C22H27Cl2NO3 — CID 4951504
2-(2,4-dichlorophenoxy)-N-(4-heptoxyphenyl)propanamide (PubChem CID 4951504) has the molecular formula C22H27Cl2NO3 and a molecular weight of 424.37 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(4-heptoxyphenyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(4-heptoxyphenyl)propanamide |
|---|---|
| PubChem CID | 4951504 |
| Molecular Formula | C22H27Cl2NO3 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 423.14 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(4-heptoxyphenyl)propanamide |
| SMILES | CCCCCCCOc1ccc(NC(=O)C(C)Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C22H27Cl2NO3/c1-3-4-5-6-7-14-27-19-11-9-18(10-12-19)25-22(26)16(2)28-21-13-8-17(23)15-20(21)24/h8-13,15-16H,3-7,14H2,1-2H3,(H,25,26) |
| InChIKey | FAMQCIPILXZKQH-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|