C21H27Cl2NO2 — CID 54798821
N-[2-(2,4-dichlorophenoxy)propyl]-4-hexoxyaniline (PubChem CID 54798821) has the molecular formula C21H27Cl2NO2 and a molecular weight of 396.36 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)propyl]-4-hexoxyaniline.
| Compound Name | N-[2-(2,4-dichlorophenoxy)propyl]-4-hexoxyaniline |
|---|---|
| PubChem CID | 54798821 |
| Molecular Formula | C21H27Cl2NO2 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)propyl]-4-hexoxyaniline |
| SMILES | CCCCCCOc1ccc(NCC(C)Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C21H27Cl2NO2/c1-3-4-5-6-13-25-19-10-8-18(9-11-19)24-15-16(2)26-21-12-7-17(22)14-20(21)23/h7-12,14,16,24H,3-6,13,15H2,1-2H3 |
| InChIKey | ZRGIZCGIQABEPJ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|