C19H23Cl2NO3 — CID 54801144
N-[2-(2,4-dichlorophenoxy)propyl]-4-(2-ethoxyethoxy)aniline (PubChem CID 54801144) has the molecular formula C19H23Cl2NO3 and a molecular weight of 384.30 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenoxy)propyl]-4-(2-ethoxyethoxy)aniline.
| Compound Name | N-[2-(2,4-dichlorophenoxy)propyl]-4-(2-ethoxyethoxy)aniline |
|---|---|
| PubChem CID | 54801144 |
| Molecular Formula | C19H23Cl2NO3 |
| Molecular Weight | 384.30 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[2-(2,4-dichlorophenoxy)propyl]-4-(2-ethoxyethoxy)aniline |
| SMILES | CCOCCOc1ccc(NCC(C)Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C19H23Cl2NO3/c1-3-23-10-11-24-17-7-5-16(6-8-17)22-13-14(2)25-19-9-4-15(20)12-18(19)21/h4-9,12,14,22H,3,10-11,13H2,1-2H3 |
| InChIKey | DBKSMSOXIODECE-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.30 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|