C20H20BrCl2N3O4S — CID 17352396
5-bromo-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-2-propoxybenzamide (PubChem CID 17352396) has the molecular formula C20H20BrCl2N3O4S and a molecular weight of 549.27 g/mol. Its IUPAC name is 5-bromo-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-2-propoxybenzamide.
| Compound Name | 5-bromo-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-2-propoxybenzamide |
|---|---|
| PubChem CID | 17352396 |
| Molecular Formula | C20H20BrCl2N3O4S |
| Molecular Weight | 549.27 g/mol |
| Exact Mass | 546.97 |
| IUPAC Name | 5-bromo-N-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamothioyl]-2-propoxybenzamide |
| SMILES | CCCOc1ccc(Br)cc1C(=O)NC(=S)NNC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H20BrCl2N3O4S/c1-3-8-29-16-6-4-12(21)9-14(16)19(28)24-20(31)26-25-18(27)11(2)30-17-7-5-13(22)10-15(17)23/h4-7,9-11H,3,8H2,1-2H3,(H,25,27)(H2,24,26,28,31) |
| InChIKey | WSEYRMWTVFDJDS-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|