C42H52N2O6 — CID 101351649
5-ethynyl-N-[5-[(5-ethynyl-2-octoxybenzoyl)amino]-2,4-dimethoxyphenyl]-2-octoxybenzamide (PubChem CID 101351649) has the molecular formula C42H52N2O6 and a molecular weight of 680.89 g/mol. Its IUPAC name is 5-ethynyl-N-[5-[(5-ethynyl-2-octoxybenzoyl)amino]-2,4-dimethoxyphenyl]-2-octoxybenzamide.
| Compound Name | 5-ethynyl-N-[5-[(5-ethynyl-2-octoxybenzoyl)amino]-2,4-dimethoxyphenyl]-2-octoxybenzamide |
|---|---|
| PubChem CID | 101351649 |
| Molecular Formula | C42H52N2O6 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.38 |
| IUPAC Name | 5-ethynyl-N-[5-[(5-ethynyl-2-octoxybenzoyl)amino]-2,4-dimethoxyphenyl]-2-octoxybenzamide |
| SMILES | C#Cc1ccc(OCCCCCCCC)c(C(=O)Nc2cc(NC(=O)c3cc(C#C)ccc3OCCCCCCCC)c(OC)cc2OC)c1 |
| InChI | InChI=1S/C42H52N2O6/c1-7-11-13-15-17-19-25-49-37-23-21-31(9-3)27-33(37)41(45)43-35-29-36(40(48-6)30-39(35)47-5)44-42(46)34-28-32(10-4)22-24-38(34)50-26-20-18-16-14-12-8-2/h3-4,21-24,27-30H,7-8,11-20,25-26H2,1-2,5-6H3,(H,43,45)(H,44,46) |
| InChIKey | LLONEHZLEMVKTE-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|