C19H30FNO4 — CID 134493053
1-[3-[3-[4-(ethylamino)-2-fluorophenoxy]propoxy]propoxy]-3-methylbutan-2-one (PubChem CID 134493053) has the molecular formula C19H30FNO4 and a molecular weight of 355.45 g/mol. Its IUPAC name is 1-[3-[3-[4-(ethylamino)-2-fluorophenoxy]propoxy]propoxy]-3-methylbutan-2-one.
| Compound Name | 1-[3-[3-[4-(ethylamino)-2-fluorophenoxy]propoxy]propoxy]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 134493053 |
| Molecular Formula | C19H30FNO4 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.22 |
| IUPAC Name | 1-[3-[3-[4-(ethylamino)-2-fluorophenoxy]propoxy]propoxy]-3-methylbutan-2-one |
| SMILES | CCNc1ccc(OCCCOCCCOCC(=O)C(C)C)c(F)c1 |
| InChI | InChI=1S/C19H30FNO4/c1-4-21-16-7-8-19(17(20)13-16)25-12-6-10-23-9-5-11-24-14-18(22)15(2)3/h7-8,13,15,21H,4-6,9-12,14H2,1-3H3 |
| InChIKey | KLNWMQNAPXCMTD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|