C24H37NO3 — CID 171081807
butane;ethane;3-methyl-1-[2-(4-pyridin-3-ylphenoxy)ethoxy]butan-2-one (PubChem CID 171081807) has the molecular formula C24H37NO3 and a molecular weight of 387.56 g/mol. Its IUPAC name is butane;ethane;3-methyl-1-[2-(4-pyridin-3-ylphenoxy)ethoxy]butan-2-one.
| Compound Name | butane;ethane;3-methyl-1-[2-(4-pyridin-3-ylphenoxy)ethoxy]butan-2-one |
|---|---|
| PubChem CID | 171081807 |
| Molecular Formula | C24H37NO3 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.28 |
| IUPAC Name | butane;ethane;3-methyl-1-[2-(4-pyridin-3-ylphenoxy)ethoxy]butan-2-one |
| SMILES | CC.CC(C)C(=O)COCCOc1ccc(-c2cccnc2)cc1.CCCC |
| InChI | InChI=1S/C18H21NO3.C4H10.C2H6/c1-14(2)18(20)13-21-10-11-22-17-7-5-15(6-8-17)16-4-3-9-19-12-16;1-3-4-2;1-2/h3-9,12,14H,10-11,13H2,1-2H3;3-4H2,1-2H3;1-2H3 |
| InChIKey | CPUVNDLJXXVNQH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|