C23H29F5O3Si — CID 67058143
3-[tert-butyl(dimethyl)silyl]oxy-1-[4-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol (PubChem CID 67058143) has the molecular formula C23H29F5O3Si and a molecular weight of 476.56 g/mol. Its IUPAC name is 3-[tert-butyl(dimethyl)silyl]oxy-1-[4-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol.
| Compound Name | 3-[tert-butyl(dimethyl)silyl]oxy-1-[4-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol |
|---|---|
| PubChem CID | 67058143 |
| Molecular Formula | C23H29F5O3Si |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 3-[tert-butyl(dimethyl)silyl]oxy-1-[4-[difluoro-[4-(trifluoromethyl)phenyl]methoxy]phenyl]propan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCC(O)c1ccc(OC(F)(F)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H29F5O3Si/c1-21(2,3)32(4,5)30-15-14-20(29)16-6-12-19(13-7-16)31-23(27,28)18-10-8-17(9-11-18)22(24,25)26/h6-13,20,29H,14-15H2,1-5H3 |
| InChIKey | IOSNBCSBEWNGAX-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|