C29H32Cl2N4O3Si — CID 59140467
N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-4-chloro-2-[(4-chlorobenzoyl)amino]benzamide (PubChem CID 59140467) has the molecular formula C29H32Cl2N4O3Si and a molecular weight of 583.59 g/mol. Its IUPAC name is N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-4-chloro-2-[(4-chlorobenzoyl)amino]benzamide.
| Compound Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-4-chloro-2-[(4-chlorobenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 59140467 |
| Molecular Formula | C29H32Cl2N4O3Si |
| Molecular Weight | 583.59 g/mol |
| Exact Mass | 582.16 |
| IUPAC Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-4-chloro-2-[(4-chlorobenzoyl)amino]benzamide |
| SMILES | [C-]#[N+]N(CCO[Si](C)(C)C(C)(C)C)c1ccc(NC(=O)c2ccc(Cl)cc2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C29H32Cl2N4O3Si/c1-29(2,3)39(5,6)38-18-17-35(32-4)24-14-12-23(13-15-24)33-28(37)25-16-11-22(31)19-26(25)34-27(36)20-7-9-21(30)10-8-20/h7-16,19H,17-18H2,1-3,5-6H3,(H,33,37)(H,34,36) |
| InChIKey | KAVWZPLHIKWUMS-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 75.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.59 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|