C27H35ClN4O3Si — CID 69228643
4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-3-N-(4-chlorophenyl)-1-methylpyrrole-3,4-dicarboxamide (PubChem CID 69228643) has the molecular formula C27H35ClN4O3Si and a molecular weight of 527.14 g/mol. Its IUPAC name is 4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-3-N-(4-chlorophenyl)-1-methylpyrrole-3,4-dicarboxamide.
| Compound Name | 4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-3-N-(4-chlorophenyl)-1-methylpyrrole-3,4-dicarboxamide |
|---|---|
| PubChem CID | 69228643 |
| Molecular Formula | C27H35ClN4O3Si |
| Molecular Weight | 527.14 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 4-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]phenyl]-3-N-(4-chlorophenyl)-1-methylpyrrole-3,4-dicarboxamide |
| SMILES | Cn1cc(C(=O)Nc2ccc(Cl)cc2)c(C(=O)Nc2ccc(NCCO[Si](C)(C)C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C27H35ClN4O3Si/c1-27(2,3)36(5,6)35-16-15-29-20-11-13-22(14-12-20)31-26(34)24-18-32(4)17-23(24)25(33)30-21-9-7-19(28)8-10-21/h7-14,17-18,29H,15-16H2,1-6H3,(H,30,33)(H,31,34) |
| InChIKey | HUYUNOXHJONNNR-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.14 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|