C24H31FN4O3Si — CID 168757189
6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoro-2-pyridinyl)-1-methyl-2-oxoquinoline-3-carboxamide (PubChem CID 168757189) has the molecular formula C24H31FN4O3Si and a molecular weight of 470.62 g/mol. Its IUPAC name is 6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoro-2-pyridinyl)-1-methyl-2-oxoquinoline-3-carboxamide.
| Compound Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoro-2-pyridinyl)-1-methyl-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 168757189 |
| Molecular Formula | C24H31FN4O3Si |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoro-2-pyridinyl)-1-methyl-2-oxoquinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccc(F)cn2)cc2cc(NCCO[Si](C)(C)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C24H31FN4O3Si/c1-24(2,3)33(5,6)32-12-11-26-18-8-9-20-16(13-18)14-19(23(31)29(20)4)22(30)28-21-10-7-17(25)15-27-21/h7-10,13-15,26H,11-12H2,1-6H3,(H,27,28,30) |
| InChIKey | WXTLOOCONLGQGL-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|