C23H30FN5O3Si — CID 167510722
5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoropyrimidin-2-yl)-1-methyl-2-oxoquinoline-3-carboxamide (PubChem CID 167510722) has the molecular formula C23H30FN5O3Si and a molecular weight of 471.61 g/mol. Its IUPAC name is 5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoropyrimidin-2-yl)-1-methyl-2-oxoquinoline-3-carboxamide.
| Compound Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoropyrimidin-2-yl)-1-methyl-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 167510722 |
| Molecular Formula | C23H30FN5O3Si |
| Molecular Weight | 471.61 g/mol |
| Exact Mass | 471.21 |
| IUPAC Name | 5-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-N-(5-fluoropyrimidin-2-yl)-1-methyl-2-oxoquinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ncc(F)cn2)cc2c(NCCO[Si](C)(C)C(C)(C)C)cccc21 |
| InChI | InChI=1S/C23H30FN5O3Si/c1-23(2,3)33(5,6)32-11-10-25-18-8-7-9-19-16(18)12-17(21(31)29(19)4)20(30)28-22-26-13-15(24)14-27-22/h7-9,12-14,25H,10-11H2,1-6H3,(H,26,27,28,30) |
| InChIKey | IKTYWFNPWPJPLL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.61 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|