C25H31N3O3Si — CID 174050130
6-[[2-[tert-butyl(dimethyl)silyl]-2-oxoethyl]amino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 174050130) has the molecular formula C25H31N3O3Si and a molecular weight of 449.63 g/mol. Its IUPAC name is 6-[[2-[tert-butyl(dimethyl)silyl]-2-oxoethyl]amino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide.
| Compound Name | 6-[[2-[tert-butyl(dimethyl)silyl]-2-oxoethyl]amino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 174050130 |
| Molecular Formula | C25H31N3O3Si |
| Molecular Weight | 449.63 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 6-[[2-[tert-butyl(dimethyl)silyl]-2-oxoethyl]amino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccccc2)cc2cc(NCC(=O)[Si](C)(C)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C25H31N3O3Si/c1-25(2,3)32(5,6)22(29)16-26-19-12-13-21-17(14-19)15-20(24(31)28(21)4)23(30)27-18-10-8-7-9-11-18/h7-15,26H,16H2,1-6H3,(H,27,30) |
| InChIKey | GKBJIJRMTOJVDQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.63 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|