C25H33N3O3Si — CID 168757198
6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide (PubChem CID 168757198) has the molecular formula C25H33N3O3Si and a molecular weight of 451.64 g/mol. Its IUPAC name is 6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide.
| Compound Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 168757198 |
| Molecular Formula | C25H33N3O3Si |
| Molecular Weight | 451.64 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 6-[2-[tert-butyl(dimethyl)silyl]oxyethylamino]-1-methyl-2-oxo-N-phenylquinoline-3-carboxamide |
| SMILES | Cn1c(=O)c(C(=O)Nc2ccccc2)cc2cc(NCCO[Si](C)(C)C(C)(C)C)ccc21 |
| InChI | InChI=1S/C25H33N3O3Si/c1-25(2,3)32(5,6)31-15-14-26-20-12-13-22-18(16-20)17-21(24(30)28(22)4)23(29)27-19-10-8-7-9-11-19/h7-13,16-17,26H,14-15H2,1-6H3,(H,27,29) |
| InChIKey | QSLFJBRMNJJNKE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|