C28H32ClN5O3Si — CID 59140533
N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyridine-4-carboxamide (PubChem CID 59140533) has the molecular formula C28H32ClN5O3Si and a molecular weight of 550.14 g/mol. Its IUPAC name is N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyridine-4-carboxamide.
| Compound Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 59140533 |
| Molecular Formula | C28H32ClN5O3Si |
| Molecular Weight | 550.14 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-3-[(4-chlorobenzoyl)amino]pyridine-4-carboxamide |
| SMILES | [C-]#[N+]N(CCO[Si](C)(C)C(C)(C)C)c1ccc(NC(=O)c2ccncc2NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C28H32ClN5O3Si/c1-28(2,3)38(5,6)37-18-17-34(30-4)23-13-11-22(12-14-23)32-27(36)24-15-16-31-19-25(24)33-26(35)20-7-9-21(29)10-8-20/h7-16,19H,17-18H2,1-3,5-6H3,(H,32,36)(H,33,35) |
| InChIKey | LVQADJSZXCJDJN-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 87.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.14 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|