C29H32N6O3Si — CID 59799276
3-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-2-N-(4-ethynylphenyl)pyrazine-2,3-dicarboxamide (PubChem CID 59799276) has the molecular formula C29H32N6O3Si and a molecular weight of 540.70 g/mol. Its IUPAC name is 3-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-2-N-(4-ethynylphenyl)pyrazine-2,3-dicarboxamide.
| Compound Name | 3-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-2-N-(4-ethynylphenyl)pyrazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 59799276 |
| Molecular Formula | C29H32N6O3Si |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.23 |
| IUPAC Name | 3-N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-isocyanoamino]phenyl]-2-N-(4-ethynylphenyl)pyrazine-2,3-dicarboxamide |
| SMILES | [C-]#[N+]N(CCO[Si](C)(C)C(C)(C)C)c1ccc(NC(=O)c2nccnc2C(=O)Nc2ccc(C#C)cc2)cc1 |
| InChI | InChI=1S/C29H32N6O3Si/c1-8-21-9-11-22(12-10-21)33-27(36)25-26(32-18-17-31-25)28(37)34-23-13-15-24(16-14-23)35(30-5)19-20-38-39(6,7)29(2,3)4/h1,9-18H,19-20H2,2-4,6-7H3,(H,33,36)(H,34,37) |
| InChIKey | VQRHEILTXSJABR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 100.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|