C28H30ClF3N4O3SSi — CID 86637731
N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]carbamoyl]-5-(trifluoromethyl)phenyl]-5-chlorothiophene-2-carboxamide (PubChem CID 86637731) has the molecular formula C28H30ClF3N4O3SSi and a molecular weight of 623.17 g/mol. Its IUPAC name is N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]carbamoyl]-5-(trifluoromethyl)phenyl]-5-chlorothiophene-2-carboxamide.
| Compound Name | N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]carbamoyl]-5-(trifluoromethyl)phenyl]-5-chlorothiophene-2-carboxamide |
|---|---|
| PubChem CID | 86637731 |
| Molecular Formula | C28H30ClF3N4O3SSi |
| Molecular Weight | 623.17 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | N-[2-[[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]carbamoyl]-5-(trifluoromethyl)phenyl]-5-chlorothiophene-2-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(C#N)c1ccc(NC(=O)c2ccc(C(F)(F)F)cc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C28H30ClF3N4O3SSi/c1-27(2,3)41(4,5)39-15-14-36(17-33)20-9-7-19(8-10-20)34-25(37)21-11-6-18(28(30,31)32)16-22(21)35-26(38)23-12-13-24(29)40-23/h6-13,16H,14-15H2,1-5H3,(H,34,37)(H,35,38) |
| InChIKey | SFHCTMYGTLRYDH-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.17 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|