C15H15ClN4O — CID 122516746
N-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrazine-2-carboxamide (PubChem CID 122516746) has the molecular formula C15H15ClN4O and a molecular weight of 302.76 g/mol. Its IUPAC name is N-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrazine-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 122516746 |
| Molecular Formula | C15H15ClN4O |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | N-(4-chlorophenyl)-3-(cyclopropylmethylamino)pyrazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1nccnc1NCC1CC1 |
| InChI | InChI=1S/C15H15ClN4O/c16-11-3-5-12(6-4-11)20-15(21)13-14(18-8-7-17-13)19-9-10-1-2-10/h3-8,10H,1-2,9H2,(H,18,19)(H,20,21) |
| InChIKey | QVQIJNSNWSFCQQ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |