C26H30ClN5O3SSi — CID 86637740
N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-2-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carboxamide (PubChem CID 86637740) has the molecular formula C26H30ClN5O3SSi and a molecular weight of 556.16 g/mol. Its IUPAC name is N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-2-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carboxamide.
| Compound Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-2-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86637740 |
| Molecular Formula | C26H30ClN5O3SSi |
| Molecular Weight | 556.16 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | N-[4-[2-[tert-butyl(dimethyl)silyl]oxyethyl-cyanoamino]phenyl]-2-[(5-chlorothiophene-2-carbonyl)amino]pyridine-3-carboxamide |
| SMILES | CC(C)(C)[Si](C)(C)OCCN(C#N)c1ccc(NC(=O)c2cccnc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C26H30ClN5O3SSi/c1-26(2,3)37(4,5)35-16-15-32(17-28)19-10-8-18(9-11-19)30-24(33)20-7-6-14-29-23(20)31-25(34)21-12-13-22(27)36-21/h6-14H,15-16H2,1-5H3,(H,30,33)(H,29,31,34) |
| InChIKey | OPKWAEPRHVAJNA-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 107.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.16 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|