C21H20ClN5O3S — CID 158314538
2-[(5-chlorothiophene-2-carbonyl)amino]-N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]pyridine-3-carboxamide;methane (PubChem CID 158314538) has the molecular formula C21H20ClN5O3S and a molecular weight of 457.94 g/mol. Its IUPAC name is 2-[(5-chlorothiophene-2-carbonyl)amino]-N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]pyridine-3-carboxamide;methane.
| Compound Name | 2-[(5-chlorothiophene-2-carbonyl)amino]-N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]pyridine-3-carboxamide;methane |
|---|---|
| PubChem CID | 158314538 |
| Molecular Formula | C21H20ClN5O3S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.10 |
| IUPAC Name | 2-[(5-chlorothiophene-2-carbonyl)amino]-N-[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]pyridine-3-carboxamide;methane |
| SMILES | C.[H]/N=C1\OCCN1c1ccc(NC(=O)c2cccnc2NC(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C20H16ClN5O3S.CH4/c21-16-8-7-15(30-16)19(28)25-17-14(2-1-9-23-17)18(27)24-12-3-5-13(6-4-12)26-10-11-29-20(26)22;/h1-9,22H,10-11H2,(H,24,27)(H,23,25,28);1H4/b22-20-; |
| InChIKey | GOCFTOLTZYEHMG-KGYDJYTLSA-N |
| XLogP | 4.71 |
| TPSA | 107.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|