C23H21ClN4O6S2 — CID 87710144
[N-(5-chlorothiophene-2-carbonyl)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylanilino]methanesulfonic acid (PubChem CID 87710144) has the molecular formula C23H21ClN4O6S2 and a molecular weight of 549.03 g/mol. Its IUPAC name is [N-(5-chlorothiophene-2-carbonyl)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylanilino]methanesulfonic acid.
| Compound Name | [N-(5-chlorothiophene-2-carbonyl)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylanilino]methanesulfonic acid |
|---|---|
| PubChem CID | 87710144 |
| Molecular Formula | C23H21ClN4O6S2 |
| Molecular Weight | 549.03 g/mol |
| Exact Mass | 548.06 |
| IUPAC Name | [N-(5-chlorothiophene-2-carbonyl)-2-[[4-(2-imino-1,3-oxazolidin-3-yl)phenyl]carbamoyl]-5-methylanilino]methanesulfonic acid |
| SMILES | [H]/N=C1\OCCN1c1ccc(NC(=O)c2ccc(C)cc2N(CS(=O)(=O)O)C(=O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C23H21ClN4O6S2/c1-14-2-7-17(21(29)26-15-3-5-16(6-4-15)27-10-11-34-23(27)25)18(12-14)28(13-36(31,32)33)22(30)19-8-9-20(24)35-19/h2-9,12,25H,10-11,13H2,1H3,(H,26,29)(H,31,32,33)/b25-23- |
| InChIKey | NVGOXYOZSKYJGK-BZZOAKBMSA-N |
| XLogP | 4.23 |
| TPSA | 140.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.03 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|